About 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline
4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline (PubChem CID 154532686) has the molecular formula C16H16Cl2N4O2
and a molecular weight of 367.24 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline |
| PubChem CID | 154532686 |
| Molecular Formula | C16H16Cl2N4O2 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline |
| SMILES | CCN(C)c1ccc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2Cl)c(C)c1 |
| InChI | InChI=1S/C16H16Cl2N4O2/c1-4-21(3)11-5-6-15(10(2)7-11)19-20-16-13(17)8-12(22(23)24)9-14(16)18/h5-9H,4H2,1-3H3/b20-19+ |
| InChIKey | UCNRFAQJCBIVLB-FMQUCBEESA-N |
| XLogP | 6.08 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline?
The IUPAC name of 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline (CID 154532686) is 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline.
What is the SMILES notation for 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline?
The canonical SMILES for 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline is CCN(C)c1ccc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2Cl)c(C)c1.
What is the InChIKey of 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline?
The InChIKey is UCNRFAQJCBIVLB-FMQUCBEESA-N. The full InChI is InChI=1S/C16H16Cl2N4O2/c1-4-21(3)11-5-6-15(10(2)7-11)19-20-16-13(17)8-12(22(23)24)9-14(16)18/h5-9H,4H2,1-3H3/b20-19+.
What are the key properties of 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline?
4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline has a molecular weight of 367.24 g/mol, XLogP of 6.08, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-N,3-dimethylaniline is sourced from PubChem (CID 154532686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).