C12H20N2 — CID 143617453
ethene;N'-methyl-N'-phenylpropane-1,3-diamine (PubChem CID 143617453) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is ethene;N'-methyl-N'-phenylpropane-1,3-diamine.
| Compound Name | ethene;N'-methyl-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143617453 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethene;N'-methyl-N'-phenylpropane-1,3-diamine |
| SMILES | C=C.CN(CCCN)c1ccccc1 |
| InChI | InChI=1S/C10H16N2.C2H4/c1-12(9-5-8-11)10-6-3-2-4-7-10;1-2/h2-4,6-7H,5,8-9,11H2,1H3;1-2H2 |
| InChIKey | KXQQDDIPDCVCJA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|