C18H26N2Pd-2 — CID 22967947
carbanide;N,N'-dimethyl-N,N'-diphenylethane-1,2-diamine;palladium (PubChem CID 22967947) has the molecular formula C18H26N2Pd-2 and a molecular weight of 376.84 g/mol. Its IUPAC name is carbanide;N,N'-dimethyl-N,N'-diphenylethane-1,2-diamine;palladium.
| Compound Name | carbanide;N,N'-dimethyl-N,N'-diphenylethane-1,2-diamine;palladium |
|---|---|
| PubChem CID | 22967947 |
| Molecular Formula | C18H26N2Pd-2 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | carbanide;N,N'-dimethyl-N,N'-diphenylethane-1,2-diamine;palladium |
| SMILES | CN(CCN(C)c1ccccc1)c1ccccc1.[CH3-].[CH3-].[Pd] |
| InChI | InChI=1S/C16H20N2.2CH3.Pd/c1-17(15-9-5-3-6-10-15)13-14-18(2)16-11-7-4-8-12-16;;;/h3-12H,13-14H2,1-2H3;2*1H3;/q;2*-1; |
| InChIKey | QEVCHTMJGNRJSU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|