C17H24N2 — CID 142921032
ethane;N'-methyl-N,N'-diphenylethane-1,2-diamine (PubChem CID 142921032) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is ethane;N'-methyl-N,N'-diphenylethane-1,2-diamine.
| Compound Name | ethane;N'-methyl-N,N'-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 142921032 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | ethane;N'-methyl-N,N'-diphenylethane-1,2-diamine |
| SMILES | CC.CN(CCNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18N2.C2H6/c1-17(15-10-6-3-7-11-15)13-12-16-14-8-4-2-5-9-14;1-2/h2-11,16H,12-13H2,1H3;1-2H3 |
| InChIKey | FZOUEZHIWCHGSF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |