C16H28N2 — CID 61378856
N',N'-bis(2-methylpropyl)-N-phenylethane-1,2-diamine (PubChem CID 61378856) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N',N'-bis(2-methylpropyl)-N-phenylethane-1,2-diamine.
| Compound Name | N',N'-bis(2-methylpropyl)-N-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 61378856 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N',N'-bis(2-methylpropyl)-N-phenylethane-1,2-diamine |
| SMILES | CC(C)CN(CCNc1ccccc1)CC(C)C |
| InChI | InChI=1S/C16H28N2/c1-14(2)12-18(13-15(3)4)11-10-17-16-8-6-5-7-9-16/h5-9,14-15,17H,10-13H2,1-4H3 |
| InChIKey | RTGXEZLWYUMMDI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |