C10H14Cl2N2 — CID 28772810
N'-(3,4-dichlorophenyl)-N'-methylpropane-1,3-diamine (PubChem CID 28772810) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is N'-(3,4-dichlorophenyl)-N'-methylpropane-1,3-diamine.
| Compound Name | N'-(3,4-dichlorophenyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 28772810 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N'-(3,4-dichlorophenyl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2/c1-14(6-2-5-13)8-3-4-9(11)10(12)7-8/h3-4,7H,2,5-6,13H2,1H3 |
| InChIKey | QSQFNZHHSNRLHA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |