C28H51N — CID 59671995
N-ethyl-N-(3,7,11,15-tetramethylhexadecyl)aniline (PubChem CID 59671995) has the molecular formula C28H51N and a molecular weight of 401.72 g/mol. Its IUPAC name is N-ethyl-N-(3,7,11,15-tetramethylhexadecyl)aniline.
| Compound Name | N-ethyl-N-(3,7,11,15-tetramethylhexadecyl)aniline |
|---|---|
| PubChem CID | 59671995 |
| Molecular Formula | C28H51N |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.40 |
| IUPAC Name | N-ethyl-N-(3,7,11,15-tetramethylhexadecyl)aniline |
| SMILES | CCN(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H51N/c1-7-29(28-20-9-8-10-21-28)23-22-27(6)19-13-18-26(5)17-12-16-25(4)15-11-14-24(2)3/h8-10,20-21,24-27H,7,11-19,22-23H2,1-6H3 |
| InChIKey | MSAFOXSULVFORG-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |