C14H24N2 — CID 62424864
N'-ethyl-N-methyl-N'-phenylpentane-1,5-diamine (PubChem CID 62424864) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-phenylpentane-1,5-diamine.
| Compound Name | N'-ethyl-N-methyl-N'-phenylpentane-1,5-diamine |
|---|---|
| PubChem CID | 62424864 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N'-ethyl-N-methyl-N'-phenylpentane-1,5-diamine |
| SMILES | CCN(CCCCCNC)c1ccccc1 |
| InChI | InChI=1S/C14H24N2/c1-3-16(13-9-5-8-12-15-2)14-10-6-4-7-11-14/h4,6-7,10-11,15H,3,5,8-9,12-13H2,1-2H3 |
| InChIKey | VVUKIWRFJFCYCF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|