C17H30N2 — CID 54806414
N'-ethyl-N-heptyl-N'-phenylethane-1,2-diamine (PubChem CID 54806414) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N'-ethyl-N-heptyl-N'-phenylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-heptyl-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 54806414 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N'-ethyl-N-heptyl-N'-phenylethane-1,2-diamine |
| SMILES | CCCCCCCNCCN(CC)c1ccccc1 |
| InChI | InChI=1S/C17H30N2/c1-3-5-6-7-11-14-18-15-16-19(4-2)17-12-9-8-10-13-17/h8-10,12-13,18H,3-7,11,14-16H2,1-2H3 |
| InChIKey | QYTZNYQEBGZKPT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|