C12H17F3N2 — CID 55085608
N'-ethyl-N'-phenyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 55085608) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is N'-ethyl-N'-phenyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-phenyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55085608 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | N'-ethyl-N'-phenyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CCN(CCNCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H17F3N2/c1-2-17(11-6-4-3-5-7-11)9-8-16-10-12(13,14)15/h3-7,16H,2,8-10H2,1H3 |
| InChIKey | BVMOQHPVWKMIBF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|