About N,N-diethylaniline;hydrazine
N,N-diethylaniline;hydrazine (PubChem CID 161037544) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is N,N-diethylaniline;hydrazine.
Molecular Properties
| Compound Name | N,N-diethylaniline;hydrazine |
| PubChem CID | 161037544 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N,N-diethylaniline;hydrazine |
| SMILES | CCN(CC)c1ccccc1.NN |
| InChI | InChI=1S/C10H15N.H4N2/c1-3-11(4-2)10-8-6-5-7-9-10;1-2/h5-9H,3-4H2,1-2H3;1-2H2 |
| InChIKey | UALKADRSKIFXHX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylaniline;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylaniline;hydrazine?
The IUPAC name of N,N-diethylaniline;hydrazine (CID 161037544) is N,N-diethylaniline;hydrazine.
What is the SMILES notation for N,N-diethylaniline;hydrazine?
The canonical SMILES for N,N-diethylaniline;hydrazine is CCN(CC)c1ccccc1.NN.
What is the InChIKey of N,N-diethylaniline;hydrazine?
The InChIKey is UALKADRSKIFXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.H4N2/c1-3-11(4-2)10-8-6-5-7-9-10;1-2/h5-9H,3-4H2,1-2H3;1-2H2.
What are the key properties of N,N-diethylaniline;hydrazine?
N,N-diethylaniline;hydrazine has a molecular weight of 181.28 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylaniline;hydrazine is sourced from PubChem (CID 161037544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).