C16H31NO3Si — CID 173388363
N,N-diethylaniline;triethoxysilane (PubChem CID 173388363) has the molecular formula C16H31NO3Si and a molecular weight of 313.51 g/mol. Its IUPAC name is N,N-diethylaniline;triethoxysilane.
| Compound Name | N,N-diethylaniline;triethoxysilane |
|---|---|
| PubChem CID | 173388363 |
| Molecular Formula | C16H31NO3Si |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | N,N-diethylaniline;triethoxysilane |
| SMILES | CCN(CC)c1ccccc1.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C10H15N.C6H16O3Si/c1-3-11(4-2)10-8-6-5-7-9-10;1-4-7-10(8-5-2)9-6-3/h5-9H,3-4H2,1-2H3;10H,4-6H2,1-3H3 |
| InChIKey | VAPHBJIUEJKXDU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|