C11H17Cl2N — CID 157472052
dichloromethane;N,N-diethylaniline (PubChem CID 157472052) has the molecular formula C11H17Cl2N and a molecular weight of 234.17 g/mol. Its IUPAC name is dichloromethane;N,N-diethylaniline.
| Compound Name | dichloromethane;N,N-diethylaniline |
|---|---|
| PubChem CID | 157472052 |
| Molecular Formula | C11H17Cl2N |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | dichloromethane;N,N-diethylaniline |
| SMILES | CCN(CC)c1ccccc1.ClCCl |
| InChI | InChI=1S/C10H15N.CH2Cl2/c1-3-11(4-2)10-8-6-5-7-9-10;2-1-3/h5-9H,3-4H2,1-2H3;1H2 |
| InChIKey | BVDONZQCJZDZJR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|