C14H31N — CID 118054380
(3R)-3,11-dimethyldodecan-1-amine (PubChem CID 118054380) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is (3R)-3,11-dimethyldodecan-1-amine.
| Compound Name | (3R)-3,11-dimethyldodecan-1-amine |
|---|---|
| PubChem CID | 118054380 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | (3R)-3,11-dimethyldodecan-1-amine |
| SMILES | CC(C)CCCCCCC[C@@H](C)CCN |
| InChI | InChI=1S/C14H31N/c1-13(2)9-7-5-4-6-8-10-14(3)11-12-15/h13-14H,4-12,15H2,1-3H3/t14-/m1/s1 |
| InChIKey | VSTVUZRQCGZBQD-CQSZACIVSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|