C10H14N2O3 — CID 171867891
3-[2-(aminomethyl)phenyl]-2,3-dihydroxypropanamide (PubChem CID 171867891) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-[2-(aminomethyl)phenyl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[2-(aminomethyl)phenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171867891 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-[2-(aminomethyl)phenyl]-2,3-dihydroxypropanamide |
| SMILES | NCc1ccccc1C(O)C(O)C(N)=O |
| InChI | InChI=1S/C10H14N2O3/c11-5-6-3-1-2-4-7(6)8(13)9(14)10(12)15/h1-4,8-9,13-14H,5,11H2,(H2,12,15) |
| InChIKey | AQPMYNQNLFCCDD-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |