C10H11F2NO4 — CID 171868513
3-[2-(difluoromethoxy)phenyl]-2,3-dihydroxypropanamide (PubChem CID 171868513) has the molecular formula C10H11F2NO4 and a molecular weight of 247.20 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868513 |
| Molecular Formula | C10H11F2NO4 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C10H11F2NO4/c11-10(12)17-6-4-2-1-3-5(6)7(14)8(15)9(13)16/h1-4,7-8,10,14-15H,(H2,13,16) |
| InChIKey | BUKWKRLJXNRICM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |