C11H14F2N2O2 — CID 65236190
3-[2-(difluoromethoxy)phenyl]-3-(methylamino)propanamide (PubChem CID 65236190) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-3-(methylamino)propanamide.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 65236190 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-3-(methylamino)propanamide |
| SMILES | CNC(CC(N)=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C11H14F2N2O2/c1-15-8(6-10(14)16)7-4-2-3-5-9(7)17-11(12)13/h2-5,8,11,15H,6H2,1H3,(H2,14,16) |
| InChIKey | KHMCZSMPDXXRKB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |