C14H14BrF2NOS — CID 115847852
2-(4-bromothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylethanamine (PubChem CID 115847852) has the molecular formula C14H14BrF2NOS and a molecular weight of 362.24 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 115847852 |
| Molecular Formula | C14H14BrF2NOS |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylethanamine |
| SMILES | CNC(Cc1cc(Br)cs1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H14BrF2NOS/c1-18-12(7-10-6-9(15)8-20-10)11-4-2-3-5-13(11)19-14(16)17/h2-6,8,12,14,18H,7H2,1H3 |
| InChIKey | DCCURMJETGJQGY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |