C19H22F2N2O — CID 152610483
2,4-bis[2-(aminomethyl)phenyl]-1,5-difluoropentan-3-one (PubChem CID 152610483) has the molecular formula C19H22F2N2O and a molecular weight of 332.39 g/mol. Its IUPAC name is 2,4-bis[2-(aminomethyl)phenyl]-1,5-difluoropentan-3-one.
| Compound Name | 2,4-bis[2-(aminomethyl)phenyl]-1,5-difluoropentan-3-one |
|---|---|
| PubChem CID | 152610483 |
| Molecular Formula | C19H22F2N2O |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2,4-bis[2-(aminomethyl)phenyl]-1,5-difluoropentan-3-one |
| SMILES | NCc1ccccc1C(CF)C(=O)C(CF)c1ccccc1CN |
| InChI | InChI=1S/C19H22F2N2O/c20-9-17(15-7-3-1-5-13(15)11-22)19(24)18(10-21)16-8-4-2-6-14(16)12-23/h1-8,17-18H,9-12,22-23H2 |
| InChIKey | YZKJNIWQRLCGNL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |