2-(aminomethyl)benzoyl chloride

C8H8ClNO — CID 82503183

IUPAC2-(aminomethyl)benzoyl chloride
SMILESNCc1ccccc1C(=O)Cl
InChIInChI=1S/C8H8ClNO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5,10H2
InChIKeyUKTRWNSNMXEISR-UHFFFAOYSA-N
MW169.61 g/mol
LogP1.52
Rot. Bonds2

About 2-(aminomethyl)benzoyl chloride

2-(aminomethyl)benzoyl chloride (PubChem CID 82503183) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is 2-(aminomethyl)benzoyl chloride.

Molecular Properties

Compound Name2-(aminomethyl)benzoyl chloride
PubChem CID82503183
Molecular FormulaC8H8ClNO
Molecular Weight169.61 g/mol
Exact Mass169.03
IUPAC Name2-(aminomethyl)benzoyl chloride
SMILESNCc1ccccc1C(=O)Cl
InChIInChI=1S/C8H8ClNO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5,10H2
InChIKeyUKTRWNSNMXEISR-UHFFFAOYSA-N
XLogP1.52
TPSA43.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.61
LogP ≤ 51.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(aminomethyl)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(aminomethyl)benzoyl chloride?
The IUPAC name of 2-(aminomethyl)benzoyl chloride (CID 82503183) is 2-(aminomethyl)benzoyl chloride.
What is the SMILES notation for 2-(aminomethyl)benzoyl chloride?
The canonical SMILES for 2-(aminomethyl)benzoyl chloride is NCc1ccccc1C(=O)Cl.
What is the InChIKey of 2-(aminomethyl)benzoyl chloride?
The InChIKey is UKTRWNSNMXEISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5,10H2.
What are the key properties of 2-(aminomethyl)benzoyl chloride?
2-(aminomethyl)benzoyl chloride has a molecular weight of 169.61 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)benzoyl chloride is sourced from PubChem (CID 82503183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).