About 2-(iodomethyl)benzoyl chloride
2-(iodomethyl)benzoyl chloride (PubChem CID 89345303) has the molecular formula C8H6ClIO
and a molecular weight of 280.49 g/mol. Its IUPAC name is 2-(iodomethyl)benzoyl chloride.
Molecular Properties
| Compound Name | 2-(iodomethyl)benzoyl chloride |
| PubChem CID | 89345303 |
| Molecular Formula | C8H6ClIO |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 279.92 |
| IUPAC Name | 2-(iodomethyl)benzoyl chloride |
| SMILES | O=C(Cl)c1ccccc1CI |
| InChI | InChI=1S/C8H6ClIO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5H2 |
| InChIKey | RJZKVZLLHHDYTK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodomethyl)benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodomethyl)benzoyl chloride?
The IUPAC name of 2-(iodomethyl)benzoyl chloride (CID 89345303) is 2-(iodomethyl)benzoyl chloride.
What is the SMILES notation for 2-(iodomethyl)benzoyl chloride?
The canonical SMILES for 2-(iodomethyl)benzoyl chloride is O=C(Cl)c1ccccc1CI.
What is the InChIKey of 2-(iodomethyl)benzoyl chloride?
The InChIKey is RJZKVZLLHHDYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClIO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5H2.
What are the key properties of 2-(iodomethyl)benzoyl chloride?
2-(iodomethyl)benzoyl chloride has a molecular weight of 280.49 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethyl)benzoyl chloride is sourced from PubChem (CID 89345303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).