2-(iodomethyl)benzoyl chloride

C8H6ClIO — CID 89345303

IUPAC2-(iodomethyl)benzoyl chloride
SMILESO=C(Cl)c1ccccc1CI
InChIInChI=1S/C8H6ClIO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5H2
InChIKeyRJZKVZLLHHDYTK-UHFFFAOYSA-N
MW280.49 g/mol
LogP3.00
Rot. Bonds2

About 2-(iodomethyl)benzoyl chloride

2-(iodomethyl)benzoyl chloride (PubChem CID 89345303) has the molecular formula C8H6ClIO and a molecular weight of 280.49 g/mol. Its IUPAC name is 2-(iodomethyl)benzoyl chloride.

Molecular Properties

Compound Name2-(iodomethyl)benzoyl chloride
PubChem CID89345303
Molecular FormulaC8H6ClIO
Molecular Weight280.49 g/mol
Exact Mass279.92
IUPAC Name2-(iodomethyl)benzoyl chloride
SMILESO=C(Cl)c1ccccc1CI
InChIInChI=1S/C8H6ClIO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5H2
InChIKeyRJZKVZLLHHDYTK-UHFFFAOYSA-N
XLogP3.00
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.49
LogP ≤ 53.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-(iodomethyl)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(iodomethyl)benzoyl chloride?
The IUPAC name of 2-(iodomethyl)benzoyl chloride (CID 89345303) is 2-(iodomethyl)benzoyl chloride.
What is the SMILES notation for 2-(iodomethyl)benzoyl chloride?
The canonical SMILES for 2-(iodomethyl)benzoyl chloride is O=C(Cl)c1ccccc1CI.
What is the InChIKey of 2-(iodomethyl)benzoyl chloride?
The InChIKey is RJZKVZLLHHDYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClIO/c9-8(11)7-4-2-1-3-6(7)5-10/h1-4H,5H2.
What are the key properties of 2-(iodomethyl)benzoyl chloride?
2-(iodomethyl)benzoyl chloride has a molecular weight of 280.49 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethyl)benzoyl chloride is sourced from PubChem (CID 89345303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).