About dichloromethane;2-iodobenzoyl chloride
dichloromethane;2-iodobenzoyl chloride (PubChem CID 174929981) has the molecular formula C8H6Cl3IO
and a molecular weight of 351.40 g/mol. Its IUPAC name is dichloromethane;2-iodobenzoyl chloride.
Molecular Properties
| Compound Name | dichloromethane;2-iodobenzoyl chloride |
| PubChem CID | 174929981 |
| Molecular Formula | C8H6Cl3IO |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 349.85 |
| IUPAC Name | dichloromethane;2-iodobenzoyl chloride |
| SMILES | ClCCl.O=C(Cl)c1ccccc1I |
| InChI | InChI=1S/C7H4ClIO.CH2Cl2/c8-7(10)5-3-1-2-4-6(5)9;2-1-3/h1-4H;1H2 |
| InChIKey | CRPFKGUCYDVGRE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;2-iodobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;2-iodobenzoyl chloride?
The IUPAC name of dichloromethane;2-iodobenzoyl chloride (CID 174929981) is dichloromethane;2-iodobenzoyl chloride.
What is the SMILES notation for dichloromethane;2-iodobenzoyl chloride?
The canonical SMILES for dichloromethane;2-iodobenzoyl chloride is ClCCl.O=C(Cl)c1ccccc1I.
What is the InChIKey of dichloromethane;2-iodobenzoyl chloride?
The InChIKey is CRPFKGUCYDVGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClIO.CH2Cl2/c8-7(10)5-3-1-2-4-6(5)9;2-1-3/h1-4H;1H2.
What are the key properties of dichloromethane;2-iodobenzoyl chloride?
dichloromethane;2-iodobenzoyl chloride has a molecular weight of 351.40 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2-iodobenzoyl chloride is sourced from PubChem (CID 174929981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).