C8H4I4 — CID 139766406
1-iodo-2-(1,2,2-triiodoethenyl)benzene (PubChem CID 139766406) has the molecular formula C8H4I4 and a molecular weight of 607.74 g/mol. Its IUPAC name is 1-iodo-2-(1,2,2-triiodoethenyl)benzene.
| Compound Name | 1-iodo-2-(1,2,2-triiodoethenyl)benzene |
|---|---|
| PubChem CID | 139766406 |
| Molecular Formula | C8H4I4 |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.65 |
| IUPAC Name | 1-iodo-2-(1,2,2-triiodoethenyl)benzene |
| SMILES | IC(I)=C(I)c1ccccc1I |
| InChI | InChI=1S/C8H4I4/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4H |
| InChIKey | MBKGFEDBSUKUOW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|