About 1,2-diiodobenzene;tetrahydrofluoride
1,2-diiodobenzene;tetrahydrofluoride (PubChem CID 174612997) has the molecular formula C6H8F4I2
and a molecular weight of 409.93 g/mol. Its IUPAC name is 1,2-diiodobenzene;tetrahydrofluoride.
Molecular Properties
| Compound Name | 1,2-diiodobenzene;tetrahydrofluoride |
| PubChem CID | 174612997 |
| Molecular Formula | C6H8F4I2 |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 409.87 |
| IUPAC Name | 1,2-diiodobenzene;tetrahydrofluoride |
| SMILES | F.F.F.F.Ic1ccccc1I |
| InChI | InChI=1S/C6H4I2.4FH/c7-5-3-1-2-4-6(5)8;;;;/h1-4H;4*1H |
| InChIKey | LTKGVTDFKVYLOB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diiodobenzene;tetrahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diiodobenzene;tetrahydrofluoride?
The IUPAC name of 1,2-diiodobenzene;tetrahydrofluoride (CID 174612997) is 1,2-diiodobenzene;tetrahydrofluoride.
What is the SMILES notation for 1,2-diiodobenzene;tetrahydrofluoride?
The canonical SMILES for 1,2-diiodobenzene;tetrahydrofluoride is F.F.F.F.Ic1ccccc1I.
What is the InChIKey of 1,2-diiodobenzene;tetrahydrofluoride?
The InChIKey is LTKGVTDFKVYLOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4I2.4FH/c7-5-3-1-2-4-6(5)8;;;;/h1-4H;4*1H.
What are the key properties of 1,2-diiodobenzene;tetrahydrofluoride?
1,2-diiodobenzene;tetrahydrofluoride has a molecular weight of 409.93 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diiodobenzene;tetrahydrofluoride is sourced from PubChem (CID 174612997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).