About (2-iodophenyl)azanium
(2-iodophenyl)azanium (PubChem CID 23277841) has the molecular formula C6H7IN+
and a molecular weight of 220.03 g/mol. Its IUPAC name is (2-iodophenyl)azanium.
Molecular Properties
| Compound Name | (2-iodophenyl)azanium |
| PubChem CID | 23277841 |
| Molecular Formula | C6H7IN+ |
| Molecular Weight | 220.03 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | (2-iodophenyl)azanium |
| SMILES | [NH3+]c1ccccc1I |
| InChI | InChI=1S/C6H6IN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2/p+1 |
| InChIKey | UBPDKIDWEADHPP-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.03 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-iodophenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-iodophenyl)azanium?
The IUPAC name of (2-iodophenyl)azanium (CID 23277841) is (2-iodophenyl)azanium.
What is the SMILES notation for (2-iodophenyl)azanium?
The canonical SMILES for (2-iodophenyl)azanium is [NH3+]c1ccccc1I.
What is the InChIKey of (2-iodophenyl)azanium?
The InChIKey is UBPDKIDWEADHPP-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6IN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2/p+1.
What are the key properties of (2-iodophenyl)azanium?
(2-iodophenyl)azanium has a molecular weight of 220.03 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-iodophenyl)azanium is sourced from PubChem (CID 23277841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).