C12H6I6 — CID 139071365
1,2,3-triiodobenzene (PubChem CID 139071365) has the molecular formula C12H6I6 and a molecular weight of 911.60 g/mol. Its IUPAC name is 1,2,3-triiodobenzene.
| Compound Name | 1,2,3-triiodobenzene |
|---|---|
| PubChem CID | 139071365 |
| Molecular Formula | C12H6I6 |
| Molecular Weight | 911.60 g/mol |
| Exact Mass | 911.47 |
| IUPAC Name | 1,2,3-triiodobenzene |
| SMILES | Ic1cccc(I)c1I.Ic1cccc(I)c1I |
| InChI | InChI=1S/2C6H3I3/c2*7-4-2-1-3-5(8)6(4)9/h2*1-3H |
| InChIKey | VLRNUIWZLFMYGE-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|