C16H19I — CID 175003744
1-iodo-2,3-dimethylbenzene;1,2-xylene (PubChem CID 175003744) has the molecular formula C16H19I and a molecular weight of 338.23 g/mol. Its IUPAC name is 1-iodo-2,3-dimethylbenzene;1,2-xylene.
| Compound Name | 1-iodo-2,3-dimethylbenzene;1,2-xylene |
|---|---|
| PubChem CID | 175003744 |
| Molecular Formula | C16H19I |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-iodo-2,3-dimethylbenzene;1,2-xylene |
| SMILES | Cc1cccc(I)c1C.Cc1ccccc1C |
| InChI | InChI=1S/C8H9I.C8H10/c1-6-4-3-5-8(9)7(6)2;1-7-5-3-4-6-8(7)2/h3-5H,1-2H3;3-6H,1-2H3 |
| InChIKey | UXXZPGXLPILPRE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|