About 1-iodo-2,3-dimethylbenzene;1,2-xylene
1-iodo-2,3-dimethylbenzene;1,2-xylene (PubChem CID 175003744) has the molecular formula C16H19I
and a molecular weight of 338.23 g/mol. Its IUPAC name is 1-iodo-2,3-dimethylbenzene;1,2-xylene.
Molecular Properties
| Compound Name | 1-iodo-2,3-dimethylbenzene;1,2-xylene |
| PubChem CID | 175003744 |
| Molecular Formula | C16H19I |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-iodo-2,3-dimethylbenzene;1,2-xylene |
| SMILES | Cc1cccc(I)c1C.Cc1ccccc1C |
| InChI | InChI=1S/C8H9I.C8H10/c1-6-4-3-5-8(9)7(6)2;1-7-5-3-4-6-8(7)2/h3-5H,1-2H3;3-6H,1-2H3 |
| InChIKey | UXXZPGXLPILPRE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2,3-dimethylbenzene;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2,3-dimethylbenzene;1,2-xylene?
The IUPAC name of 1-iodo-2,3-dimethylbenzene;1,2-xylene (CID 175003744) is 1-iodo-2,3-dimethylbenzene;1,2-xylene.
What is the SMILES notation for 1-iodo-2,3-dimethylbenzene;1,2-xylene?
The canonical SMILES for 1-iodo-2,3-dimethylbenzene;1,2-xylene is Cc1cccc(I)c1C.Cc1ccccc1C.
What is the InChIKey of 1-iodo-2,3-dimethylbenzene;1,2-xylene?
The InChIKey is UXXZPGXLPILPRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9I.C8H10/c1-6-4-3-5-8(9)7(6)2;1-7-5-3-4-6-8(7)2/h3-5H,1-2H3;3-6H,1-2H3.
What are the key properties of 1-iodo-2,3-dimethylbenzene;1,2-xylene?
1-iodo-2,3-dimethylbenzene;1,2-xylene has a molecular weight of 338.23 g/mol, XLogP of 5.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2,3-dimethylbenzene;1,2-xylene is sourced from PubChem (CID 175003744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).