C9H8I2O — CID 118847001
1-(2,3-diiodophenyl)propan-2-one (PubChem CID 118847001) has the molecular formula C9H8I2O and a molecular weight of 385.97 g/mol. Its IUPAC name is 1-(2,3-diiodophenyl)propan-2-one.
| Compound Name | 1-(2,3-diiodophenyl)propan-2-one |
|---|---|
| PubChem CID | 118847001 |
| Molecular Formula | C9H8I2O |
| Molecular Weight | 385.97 g/mol |
| Exact Mass | 385.87 |
| IUPAC Name | 1-(2,3-diiodophenyl)propan-2-one |
| SMILES | CC(=O)Cc1cccc(I)c1I |
| InChI | InChI=1S/C9H8I2O/c1-6(12)5-7-3-2-4-8(10)9(7)11/h2-4H,5H2,1H3 |
| InChIKey | PBJHSDDYSYXBPA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.97 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|