C14H21IO4 — CID 175748733
acetic acid;1,3-diethyl-2-iodobenzene (PubChem CID 175748733) has the molecular formula C14H21IO4 and a molecular weight of 380.22 g/mol. Its IUPAC name is acetic acid;1,3-diethyl-2-iodobenzene.
| Compound Name | acetic acid;1,3-diethyl-2-iodobenzene |
|---|---|
| PubChem CID | 175748733 |
| Molecular Formula | C14H21IO4 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | acetic acid;1,3-diethyl-2-iodobenzene |
| SMILES | CC(=O)O.CC(=O)O.CCc1cccc(CC)c1I |
| InChI | InChI=1S/C10H13I.2C2H4O2/c1-3-8-6-5-7-9(4-2)10(8)11;2*1-2(3)4/h5-7H,3-4H2,1-2H3;2*1H3,(H,3,4) |
| InChIKey | SBZGZXOTIDWBDV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|