About 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane
1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane (PubChem CID 160931095) has the molecular formula C20H27IO2
and a molecular weight of 426.34 g/mol. Its IUPAC name is 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane.
Molecular Properties
| Compound Name | 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane |
| PubChem CID | 160931095 |
| Molecular Formula | C20H27IO2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane |
| SMILES | C.CCc1cccc(C)c1C(=O)O.CCc1cccc(C)c1I |
| InChI | InChI=1S/C10H12O2.C9H11I.CH4/c1-3-8-6-4-5-7(2)9(8)10(11)12;1-3-8-6-4-5-7(2)9(8)10;/h4-6H,3H2,1-2H3,(H,11,12);4-6H,3H2,1-2H3;1H4 |
| InChIKey | STGWGFVDANGNIS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane?
The IUPAC name of 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane (CID 160931095) is 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane.
What is the SMILES notation for 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane?
The canonical SMILES for 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane is C.CCc1cccc(C)c1C(=O)O.CCc1cccc(C)c1I.
What is the InChIKey of 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane?
The InChIKey is STGWGFVDANGNIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C9H11I.CH4/c1-3-8-6-4-5-7(2)9(8)10(11)12;1-3-8-6-4-5-7(2)9(8)10;/h4-6H,3H2,1-2H3,(H,11,12);4-6H,3H2,1-2H3;1H4.
What are the key properties of 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane?
1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane has a molecular weight of 426.34 g/mol, XLogP of 6.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-iodo-3-methylbenzene;2-ethyl-6-methylbenzoic acid;methane is sourced from PubChem (CID 160931095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).