C10H13I — CID 18690512
1,3-diethyl-2-iodobenzene (PubChem CID 18690512) has the molecular formula C10H13I and a molecular weight of 260.12 g/mol. Its IUPAC name is 1,3-diethyl-2-iodobenzene.
| Compound Name | 1,3-diethyl-2-iodobenzene |
|---|---|
| PubChem CID | 18690512 |
| Molecular Formula | C10H13I |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 1,3-diethyl-2-iodobenzene |
| SMILES | CCc1cccc(CC)c1I |
| InChI | InChI=1S/C10H13I/c1-3-8-6-5-7-9(4-2)10(8)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | VYFIQNFCPBTUGW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|