About 2,6-diethylaniline;iron(2+)
2,6-diethylaniline;iron(2+) (PubChem CID 175873065) has the molecular formula C10H15FeN+2
and a molecular weight of 205.08 g/mol. Its IUPAC name is 2,6-diethylaniline;iron(2+).
Molecular Properties
| Compound Name | 2,6-diethylaniline;iron(2+) |
| PubChem CID | 175873065 |
| Molecular Formula | C10H15FeN+2 |
| Molecular Weight | 205.08 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 2,6-diethylaniline;iron(2+) |
| SMILES | CCc1cccc(CC)c1N.[Fe+2] |
| InChI | InChI=1S/C10H15N.Fe/c1-3-8-6-5-7-9(4-2)10(8)11;/h5-7H,3-4,11H2,1-2H3;/q;+2 |
| InChIKey | ZKHHKRGXFXNCIA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.08 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diethylaniline;iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethylaniline;iron(2+)?
The IUPAC name of 2,6-diethylaniline;iron(2+) (CID 175873065) is 2,6-diethylaniline;iron(2+).
What is the SMILES notation for 2,6-diethylaniline;iron(2+)?
The canonical SMILES for 2,6-diethylaniline;iron(2+) is CCc1cccc(CC)c1N.[Fe+2].
What is the InChIKey of 2,6-diethylaniline;iron(2+)?
The InChIKey is ZKHHKRGXFXNCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.Fe/c1-3-8-6-5-7-9(4-2)10(8)11;/h5-7H,3-4,11H2,1-2H3;/q;+2.
What are the key properties of 2,6-diethylaniline;iron(2+)?
2,6-diethylaniline;iron(2+) has a molecular weight of 205.08 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethylaniline;iron(2+) is sourced from PubChem (CID 175873065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).