C13H23N — CID 174429495
2,6-diethylaniline;propane (PubChem CID 174429495) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,6-diethylaniline;propane.
| Compound Name | 2,6-diethylaniline;propane |
|---|---|
| PubChem CID | 174429495 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,6-diethylaniline;propane |
| SMILES | CCC.CCc1cccc(CC)c1N |
| InChI | InChI=1S/C10H15N.C3H8/c1-3-8-6-5-7-9(4-2)10(8)11;1-3-2/h5-7H,3-4,11H2,1-2H3;3H2,1-2H3 |
| InChIKey | IVWBPXXSDZCOGU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|