C12H16O — CID 14939611
1-(2,6-diethylphenyl)ethanone (PubChem CID 14939611) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)ethanone.
| Compound Name | 1-(2,6-diethylphenyl)ethanone |
|---|---|
| PubChem CID | 14939611 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-(2,6-diethylphenyl)ethanone |
| SMILES | CCc1cccc(CC)c1C(C)=O |
| InChI | InChI=1S/C12H16O/c1-4-10-7-6-8-11(5-2)12(10)9(3)13/h6-8H,4-5H2,1-3H3 |
| InChIKey | ONNBSUZMCFTEQD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |