About CID 159202832
CID 159202832 (PubChem CID 159202832) has the molecular formula C13H19LiOP
and a molecular weight of 229.21 g/mol.
Molecular Properties
| Compound Name | CID 159202832 |
| PubChem CID | 159202832 |
| Molecular Formula | C13H19LiOP |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | — |
| SMILES | CCPC(=O)c1c(CC)cccc1CC.[Li] |
| InChI | InChI=1S/C13H19OP.Li/c1-4-10-8-7-9-11(5-2)12(10)13(14)15-6-3;/h7-9,15H,4-6H2,1-3H3; |
| InChIKey | KPMTZDFQKFWFPT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 159202832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159202832?
The IUPAC name of CID 159202832 (CID 159202832) is not available.
What is the SMILES notation for CID 159202832?
The canonical SMILES for CID 159202832 is CCPC(=O)c1c(CC)cccc1CC.[Li].
What is the InChIKey of CID 159202832?
The InChIKey is KPMTZDFQKFWFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19OP.Li/c1-4-10-8-7-9-11(5-2)12(10)13(14)15-6-3;/h7-9,15H,4-6H2,1-3H3;.
What are the key properties of CID 159202832?
CID 159202832 has a molecular weight of 229.21 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159202832 is sourced from PubChem (CID 159202832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).