C22H30N2 — CID 12975599
(E)-N,N'-bis(2,6-diethylphenyl)ethene-1,2-diamine (PubChem CID 12975599) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is (E)-N,N'-bis(2,6-diethylphenyl)ethene-1,2-diamine.
| Compound Name | (E)-N,N'-bis(2,6-diethylphenyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 12975599 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | (E)-N,N'-bis(2,6-diethylphenyl)ethene-1,2-diamine |
| SMILES | CCc1cccc(CC)c1N/C=C/Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C22H30N2/c1-5-17-11-9-12-18(6-2)21(17)23-15-16-24-22-19(7-3)13-10-14-20(22)8-4/h9-16,23-24H,5-8H2,1-4H3/b16-15+ |
| InChIKey | NYOPWVJORURFRX-FOCLMDBBSA-N |
| XLogP | 5.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |