C16H20N2 — CID 19899251
1-(2,6-diethylphenyl)-2-phenylhydrazine (PubChem CID 19899251) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-phenylhydrazine.
| Compound Name | 1-(2,6-diethylphenyl)-2-phenylhydrazine |
|---|---|
| PubChem CID | 19899251 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-phenylhydrazine |
| SMILES | CCc1cccc(CC)c1NNc1ccccc1 |
| InChI | InChI=1S/C16H20N2/c1-3-13-9-8-10-14(4-2)16(13)18-17-15-11-6-5-7-12-15/h5-12,17-18H,3-4H2,1-2H3 |
| InChIKey | LBHBXVGIGZARQC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|