C16H19N3 — CID 70579613
N-[(2,3-diethylphenyl)diazenyl]aniline (PubChem CID 70579613) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[(2,3-diethylphenyl)diazenyl]aniline.
| Compound Name | N-[(2,3-diethylphenyl)diazenyl]aniline |
|---|---|
| PubChem CID | 70579613 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-[(2,3-diethylphenyl)diazenyl]aniline |
| SMILES | CCc1cccc(/N=N/Nc2ccccc2)c1CC |
| InChI | InChI=1S/C16H19N3/c1-3-13-9-8-12-16(15(13)4-2)18-19-17-14-10-6-5-7-11-14/h5-12H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | RTIZCGRDTLGMDB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|