C17H18N2 — CID 87072891
N'-(2,3-diethylphenyl)-N-phenylmethanediimine (PubChem CID 87072891) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N'-(2,3-diethylphenyl)-N-phenylmethanediimine.
| Compound Name | N'-(2,3-diethylphenyl)-N-phenylmethanediimine |
|---|---|
| PubChem CID | 87072891 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N'-(2,3-diethylphenyl)-N-phenylmethanediimine |
| SMILES | CCc1cccc(N=C=Nc2ccccc2)c1CC |
| InChI | InChI=1S/C17H18N2/c1-3-14-9-8-12-17(16(14)4-2)19-13-18-15-10-6-5-7-11-15/h5-12H,3-4H2,1-2H3 |
| InChIKey | WYLSKWDWHWKNOE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|