About anisole;N,N'-diphenylmethanediimine
anisole;N,N'-diphenylmethanediimine (PubChem CID 157139667) has the molecular formula C27H26N2O2
and a molecular weight of 410.52 g/mol. Its IUPAC name is anisole;N,N'-diphenylmethanediimine.
Molecular Properties
| Compound Name | anisole;N,N'-diphenylmethanediimine |
| PubChem CID | 157139667 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | anisole;N,N'-diphenylmethanediimine |
| SMILES | C(=Nc1ccccc1)=Nc1ccccc1.COc1ccccc1.COc1ccccc1 |
| InChI | InChI=1S/C13H10N2.2C7H8O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2*1-8-7-5-3-2-4-6-7/h1-10H;2*2-6H,1H3 |
| InChIKey | AKAVSNJGEKUMCO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze anisole;N,N'-diphenylmethanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;N,N'-diphenylmethanediimine?
The IUPAC name of anisole;N,N'-diphenylmethanediimine (CID 157139667) is anisole;N,N'-diphenylmethanediimine.
What is the SMILES notation for anisole;N,N'-diphenylmethanediimine?
The canonical SMILES for anisole;N,N'-diphenylmethanediimine is C(=Nc1ccccc1)=Nc1ccccc1.COc1ccccc1.COc1ccccc1.
What is the InChIKey of anisole;N,N'-diphenylmethanediimine?
The InChIKey is AKAVSNJGEKUMCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2.2C7H8O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2*1-8-7-5-3-2-4-6-7/h1-10H;2*2-6H,1H3.
What are the key properties of anisole;N,N'-diphenylmethanediimine?
anisole;N,N'-diphenylmethanediimine has a molecular weight of 410.52 g/mol, XLogP of 7.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;N,N'-diphenylmethanediimine is sourced from PubChem (CID 157139667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).