About N,N'-diphenylmethanediimine;fluoromethane
N,N'-diphenylmethanediimine;fluoromethane (PubChem CID 158642010) has the molecular formula C15H16F2N2
and a molecular weight of 262.30 g/mol. Its IUPAC name is N,N'-diphenylmethanediimine;fluoromethane.
Molecular Properties
| Compound Name | N,N'-diphenylmethanediimine;fluoromethane |
| PubChem CID | 158642010 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N,N'-diphenylmethanediimine;fluoromethane |
| SMILES | C(=Nc1ccccc1)=Nc1ccccc1.CF.CF |
| InChI | InChI=1S/C13H10N2.2CH3F/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2*1-2/h1-10H;2*1H3 |
| InChIKey | IAMSEBKXSFPAMQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diphenylmethanediimine;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diphenylmethanediimine;fluoromethane?
The IUPAC name of N,N'-diphenylmethanediimine;fluoromethane (CID 158642010) is N,N'-diphenylmethanediimine;fluoromethane.
What is the SMILES notation for N,N'-diphenylmethanediimine;fluoromethane?
The canonical SMILES for N,N'-diphenylmethanediimine;fluoromethane is C(=Nc1ccccc1)=Nc1ccccc1.CF.CF.
What is the InChIKey of N,N'-diphenylmethanediimine;fluoromethane?
The InChIKey is IAMSEBKXSFPAMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2.2CH3F/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2*1-2/h1-10H;2*1H3.
What are the key properties of N,N'-diphenylmethanediimine;fluoromethane?
N,N'-diphenylmethanediimine;fluoromethane has a molecular weight of 262.30 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diphenylmethanediimine;fluoromethane is sourced from PubChem (CID 158642010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).