C19H22N2O — CID 56983178
4-(phenyliminomethylideneamino)-2,6-di(propan-2-yl)phenol (PubChem CID 56983178) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-(phenyliminomethylideneamino)-2,6-di(propan-2-yl)phenol.
| Compound Name | 4-(phenyliminomethylideneamino)-2,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 56983178 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-(phenyliminomethylideneamino)-2,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(N=C=Nc2ccccc2)cc(C(C)C)c1O |
| InChI | InChI=1S/C19H22N2O/c1-13(2)17-10-16(11-18(14(3)4)19(17)22)21-12-20-15-8-6-5-7-9-15/h5-11,13-14,22H,1-4H3 |
| InChIKey | PZGRNAWHBXOOJY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|