C11H13NS — CID 122700830
1,2-diethyl-3-isothiocyanatobenzene (PubChem CID 122700830) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 1,2-diethyl-3-isothiocyanatobenzene.
| Compound Name | 1,2-diethyl-3-isothiocyanatobenzene |
|---|---|
| PubChem CID | 122700830 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1,2-diethyl-3-isothiocyanatobenzene |
| SMILES | CCc1cccc(N=C=S)c1CC |
| InChI | InChI=1S/C11H13NS/c1-3-9-6-5-7-11(12-8-13)10(9)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | NSUJQORSECDXCU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|