C11H13NO — CID 141200893
(2,3-diethylphenyl) cyanate (PubChem CID 141200893) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (2,3-diethylphenyl) cyanate.
| Compound Name | (2,3-diethylphenyl) cyanate |
|---|---|
| PubChem CID | 141200893 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (2,3-diethylphenyl) cyanate |
| SMILES | CCc1cccc(OC#N)c1CC |
| InChI | InChI=1S/C11H13NO/c1-3-9-6-5-7-11(13-8-12)10(9)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | LTRYUBHAYXWUKK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|