C14H22O3 — CID 54400320
1,2-diethyl-3-(2-methoxyethoxymethoxy)benzene (PubChem CID 54400320) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,2-diethyl-3-(2-methoxyethoxymethoxy)benzene.
| Compound Name | 1,2-diethyl-3-(2-methoxyethoxymethoxy)benzene |
|---|---|
| PubChem CID | 54400320 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1,2-diethyl-3-(2-methoxyethoxymethoxy)benzene |
| SMILES | CCc1cccc(OCOCCOC)c1CC |
| InChI | InChI=1S/C14H22O3/c1-4-12-7-6-8-14(13(12)5-2)17-11-16-10-9-15-3/h6-8H,4-5,9-11H2,1-3H3 |
| InChIKey | JIPOKSMWVFODAL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|