About ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate
ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate (PubChem CID 144784609) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate.
Molecular Properties
| Compound Name | ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate |
| PubChem CID | 144784609 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate |
| SMILES | CC.CCc1cccc(OC#N)c1COc1ccccn1 |
| InChI | InChI=1S/C15H14N2O2.C2H6/c1-2-12-6-5-7-14(19-11-16)13(12)10-18-15-8-3-4-9-17-15;1-2/h3-9H,2,10H2,1H3;1-2H3 |
| InChIKey | YKHWYNYKMBTUGK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate?
The IUPAC name of ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate (CID 144784609) is ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate.
What is the SMILES notation for ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate?
The canonical SMILES for ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate is CC.CCc1cccc(OC#N)c1COc1ccccn1.
What is the InChIKey of ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate?
The InChIKey is YKHWYNYKMBTUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2.C2H6/c1-2-12-6-5-7-14(19-11-16)13(12)10-18-15-8-3-4-9-17-15;1-2/h3-9H,2,10H2,1H3;1-2H3.
What are the key properties of ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate?
ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate has a molecular weight of 284.36 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[3-ethyl-2-(pyridin-2-yloxymethyl)phenyl] cyanate is sourced from PubChem (CID 144784609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).