C26H32O8P2 — CID 21263253
[3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]oxyphenyl] (2,3-diethylphenyl) hydrogen phosphate (PubChem CID 21263253) has the molecular formula C26H32O8P2 and a molecular weight of 534.48 g/mol. Its IUPAC name is [3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]oxyphenyl] (2,3-diethylphenyl) hydrogen phosphate.
| Compound Name | [3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]oxyphenyl] (2,3-diethylphenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 21263253 |
| Molecular Formula | C26H32O8P2 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]oxyphenyl] (2,3-diethylphenyl) hydrogen phosphate |
| SMILES | CCc1cccc(OP(=O)(O)Oc2cccc(OP(=O)(O)Oc3cccc(CC)c3CC)c2)c1CC |
| InChI | InChI=1S/C26H32O8P2/c1-5-19-12-9-16-25(23(19)7-3)33-35(27,28)31-21-14-11-15-22(18-21)32-36(29,30)34-26-17-10-13-20(6-2)24(26)8-4/h9-18H,5-8H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | JUQPDFXMHNGSGM-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|