About 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid
3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid (PubChem CID 56628902) has the molecular formula C15H26O6P2
and a molecular weight of 364.32 g/mol. Its IUPAC name is 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid.
Molecular Properties
| Compound Name | 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid |
| PubChem CID | 56628902 |
| Molecular Formula | C15H26O6P2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid |
| SMILES | CCc1cccc(OP(=O)(O)C(CC)(CC)P(=O)(O)O)c1CC |
| InChI | InChI=1S/C15H26O6P2/c1-5-12-10-9-11-14(13(12)6-2)21-23(19,20)15(7-3,8-4)22(16,17)18/h9-11H,5-8H2,1-4H3,(H,19,20)(H2,16,17,18) |
| InChIKey | VYIMBULLEABKRN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid?
The IUPAC name of 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid (CID 56628902) is 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid.
What is the SMILES notation for 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid?
The canonical SMILES for 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid is CCc1cccc(OP(=O)(O)C(CC)(CC)P(=O)(O)O)c1CC.
What is the InChIKey of 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid?
The InChIKey is VYIMBULLEABKRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O6P2/c1-5-12-10-9-11-14(13(12)6-2)21-23(19,20)15(7-3,8-4)22(16,17)18/h9-11H,5-8H2,1-4H3,(H,19,20)(H2,16,17,18).
What are the key properties of 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid?
3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid has a molecular weight of 364.32 g/mol, XLogP of 4.07, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-diethylphenoxy)-hydroxyphosphoryl]pentan-3-ylphosphonic acid is sourced from PubChem (CID 56628902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).