About (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate
(2,3-diethylphenyl) prop-1-enyl hydrogen phosphate (PubChem CID 160609336) has the molecular formula C13H19O4P
and a molecular weight of 270.26 g/mol. Its IUPAC name is (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate.
Molecular Properties
| Compound Name | (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate |
| PubChem CID | 160609336 |
| Molecular Formula | C13H19O4P |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate |
| SMILES | CC=COP(=O)(O)Oc1cccc(CC)c1CC |
| InChI | InChI=1S/C13H19O4P/c1-4-10-16-18(14,15)17-13-9-7-8-11(5-2)12(13)6-3/h4,7-10H,5-6H2,1-3H3,(H,14,15) |
| InChIKey | RFHLYHCMNCCJHK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate?
The IUPAC name of (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate (CID 160609336) is (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate.
What is the SMILES notation for (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate?
The canonical SMILES for (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate is CC=COP(=O)(O)Oc1cccc(CC)c1CC.
What is the InChIKey of (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate?
The InChIKey is RFHLYHCMNCCJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19O4P/c1-4-10-16-18(14,15)17-13-9-7-8-11(5-2)12(13)6-3/h4,7-10H,5-6H2,1-3H3,(H,14,15).
What are the key properties of (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate?
(2,3-diethylphenyl) prop-1-enyl hydrogen phosphate has a molecular weight of 270.26 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-diethylphenyl) prop-1-enyl hydrogen phosphate is sourced from PubChem (CID 160609336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).