About [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate
[(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate (PubChem CID 23077154) has the molecular formula C11H13O6P
and a molecular weight of 272.19 g/mol. Its IUPAC name is [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate.
Molecular Properties
| Compound Name | [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate |
| PubChem CID | 23077154 |
| Molecular Formula | C11H13O6P |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOP(=O)(O)Oc1ccccc1CC |
| InChI | InChI=1S/C11H13O6P/c1-3-9-7-5-6-8-10(9)16-18(13,14)17-15-11(12)4-2/h4-8H,2-3H2,1H3,(H,13,14) |
| InChIKey | YVSJJENLCVMGPR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate?
The IUPAC name of [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate (CID 23077154) is [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate.
What is the SMILES notation for [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate?
The canonical SMILES for [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate is C=CC(=O)OOP(=O)(O)Oc1ccccc1CC.
What is the InChIKey of [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate?
The InChIKey is YVSJJENLCVMGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O6P/c1-3-9-7-5-6-8-10(9)16-18(13,14)17-15-11(12)4-2/h4-8H,2-3H2,1H3,(H,13,14).
What are the key properties of [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate?
[(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate has a molecular weight of 272.19 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-ethylphenoxy)-hydroxyphosphoryl] prop-2-eneperoxoate is sourced from PubChem (CID 23077154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).